C18H38O2Si — CID 134901058
2,2-dimethyl-1-[(2R,3S)-3-octyl-2-trimethylsilyloxiran-2-yl]propan-1-ol (PubChem CID 134901058) has the molecular formula C18H38O2Si and a molecular weight of 314.59 g/mol. Its IUPAC name is 2,2-dimethyl-1-[(2R,3S)-3-octyl-2-trimethylsilyloxiran-2-yl]propan-1-ol.
| Compound Name | 2,2-dimethyl-1-[(2R,3S)-3-octyl-2-trimethylsilyloxiran-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 134901058 |
| Molecular Formula | C18H38O2Si |
| Molecular Weight | 314.59 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | 2,2-dimethyl-1-[(2R,3S)-3-octyl-2-trimethylsilyloxiran-2-yl]propan-1-ol |
| SMILES | CCCCCCCC[C@@H]1O[C@]1(C(O)C(C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C18H38O2Si/c1-8-9-10-11-12-13-14-15-18(20-15,21(5,6)7)16(19)17(2,3)4/h15-16,19H,8-14H2,1-7H3/t15-,16?,18-/m0/s1 |
| InChIKey | NSGHJVUOMZNUKZ-SPQDMEGHSA-N |
| XLogP | 5.16 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.59 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|