C25H52O3Si — CID 10071268
1-[3-[1-[tert-butyl(dimethyl)silyl]oxydecyl]oxiran-2-yl]-5-methylhexan-1-ol (PubChem CID 10071268) has the molecular formula C25H52O3Si and a molecular weight of 428.77 g/mol. Its IUPAC name is 1-[3-[1-[tert-butyl(dimethyl)silyl]oxydecyl]oxiran-2-yl]-5-methylhexan-1-ol.
| Compound Name | 1-[3-[1-[tert-butyl(dimethyl)silyl]oxydecyl]oxiran-2-yl]-5-methylhexan-1-ol |
|---|---|
| PubChem CID | 10071268 |
| Molecular Formula | C25H52O3Si |
| Molecular Weight | 428.77 g/mol |
| Exact Mass | 428.37 |
| IUPAC Name | 1-[3-[1-[tert-butyl(dimethyl)silyl]oxydecyl]oxiran-2-yl]-5-methylhexan-1-ol |
| SMILES | CCCCCCCCCC(O[Si](C)(C)C(C)(C)C)C1OC1C(O)CCCC(C)C |
| InChI | InChI=1S/C25H52O3Si/c1-9-10-11-12-13-14-15-19-22(28-29(7,8)25(4,5)6)24-23(27-24)21(26)18-16-17-20(2)3/h20-24,26H,9-19H2,1-8H3 |
| InChIKey | PZMOKAOXCVKMOE-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.77 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|