About CID 134902760
CID 134902760 (PubChem CID 134902760) has the molecular formula C13H9
and a molecular weight of 165.21 g/mol.
Molecular Properties
| Compound Name | CID 134902760 |
| PubChem CID | 134902760 |
| Molecular Formula | C13H9 |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | — |
| SMILES | C1=C[C]2C(=C1)C=Cc1ccccc12 |
| InChI | InChI=1S/C13H9/c1-2-6-12-10(4-1)8-9-11-5-3-7-13(11)12/h1-9H |
| InChIKey | JJPINSLEXUWOAE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 134902760 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134902760?
The IUPAC name of CID 134902760 (CID 134902760) is not available.
What is the SMILES notation for CID 134902760?
The canonical SMILES for CID 134902760 is C1=C[C]2C(=C1)C=Cc1ccccc12.
What is the InChIKey of CID 134902760?
The InChIKey is JJPINSLEXUWOAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9/c1-2-6-12-10(4-1)8-9-11-5-3-7-13(11)12/h1-9H.
What are the key properties of CID 134902760?
CID 134902760 has a molecular weight of 165.21 g/mol, XLogP of 3.13, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134902760 is sourced from PubChem (CID 134902760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).