C31H50O6Si — CID 134903463
(4S,6R,11R)-11-[(E,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-1-enyl]-2,2-dimethyl-4-(phenylmethoxymethyl)-1,3,7-trioxaspiro[5.5]undecan-9-one (PubChem CID 134903463) has the molecular formula C31H50O6Si and a molecular weight of 546.82 g/mol. Its IUPAC name is (4S,6R,11R)-11-[(E,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-1-enyl]-2,2-dimethyl-4-(phenylmethoxymethyl)-1,3,7-trioxaspiro[5.5]undecan-9-one.
| Compound Name | (4S,6R,11R)-11-[(E,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-1-enyl]-2,2-dimethyl-4-(phenylmethoxymethyl)-1,3,7-trioxaspiro[5.5]undecan-9-one |
|---|---|
| PubChem CID | 134903463 |
| Molecular Formula | C31H50O6Si |
| Molecular Weight | 546.82 g/mol |
| Exact Mass | 546.34 |
| IUPAC Name | (4S,6R,11R)-11-[(E,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-1-enyl]-2,2-dimethyl-4-(phenylmethoxymethyl)-1,3,7-trioxaspiro[5.5]undecan-9-one |
| SMILES | C/C(=C\[C@H]1CC(=O)CO[C@@]12C[C@@H](COCc1ccccc1)OC(C)(C)O2)C[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H50O6Si/c1-23(15-24(2)19-35-38(8,9)29(3,4)5)16-26-17-27(32)21-34-31(26)18-28(36-30(6,7)37-31)22-33-20-25-13-11-10-12-14-25/h10-14,16,24,26,28H,15,17-22H2,1-9H3/b23-16+/t24-,26-,28-,31+/m0/s1 |
| InChIKey | AIQOESHYNQFYKG-YDZKHIKPSA-N |
| XLogP | 7.04 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.82 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|