C37H57NO5Si2 — CID 134904555
1-[(2S,3R,4S,5R,6R)-7-[tert-butyl(diphenyl)silyl]oxy-2-ethenyl-3-hydroxy-4,6-dimethyl-5-triethylsilyloxyheptanoyl]pyrrolidin-2-one (PubChem CID 134904555) has the molecular formula C37H57NO5Si2 and a molecular weight of 652.04 g/mol. Its IUPAC name is 1-[(2S,3R,4S,5R,6R)-7-[tert-butyl(diphenyl)silyl]oxy-2-ethenyl-3-hydroxy-4,6-dimethyl-5-triethylsilyloxyheptanoyl]pyrrolidin-2-one.
| Compound Name | 1-[(2S,3R,4S,5R,6R)-7-[tert-butyl(diphenyl)silyl]oxy-2-ethenyl-3-hydroxy-4,6-dimethyl-5-triethylsilyloxyheptanoyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 134904555 |
| Molecular Formula | C37H57NO5Si2 |
| Molecular Weight | 652.04 g/mol |
| Exact Mass | 651.38 |
| IUPAC Name | 1-[(2S,3R,4S,5R,6R)-7-[tert-butyl(diphenyl)silyl]oxy-2-ethenyl-3-hydroxy-4,6-dimethyl-5-triethylsilyloxyheptanoyl]pyrrolidin-2-one |
| SMILES | C=C[C@H](C(=O)N1CCCC1=O)[C@H](O)[C@H](C)[C@H](O[Si](CC)(CC)CC)[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C37H57NO5Si2/c1-10-32(36(41)38-26-20-25-33(38)39)34(40)29(6)35(43-44(11-2,12-3)13-4)28(5)27-42-45(37(7,8)9,30-21-16-14-17-22-30)31-23-18-15-19-24-31/h10,14-19,21-24,28-29,32,34-35,40H,1,11-13,20,25-27H2,2-9H3/t28-,29+,32+,34-,35-/m1/s1 |
| InChIKey | LYHMOXRUBQAKFJ-HVOHTJDWSA-N |
| XLogP | 6.54 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.04 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|