C36H51NO7Si — CID 134931116
3-[(2S,3S,4S)-2-[(4R,5R,6R)-6-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-3-hydroxy-4-methylhex-5-enoyl]-1,3-oxazolidin-2-one (PubChem CID 134931116) has the molecular formula C36H51NO7Si and a molecular weight of 637.89 g/mol. Its IUPAC name is 3-[(2S,3S,4S)-2-[(4R,5R,6R)-6-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-3-hydroxy-4-methylhex-5-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(2S,3S,4S)-2-[(4R,5R,6R)-6-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-3-hydroxy-4-methylhex-5-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134931116 |
| Molecular Formula | C36H51NO7Si |
| Molecular Weight | 637.89 g/mol |
| Exact Mass | 637.34 |
| IUPAC Name | 3-[(2S,3S,4S)-2-[(4R,5R,6R)-6-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-3-hydroxy-4-methylhex-5-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C=C[C@H](C)[C@H](O)[C@H](C(=O)N1CCOC1=O)[C@@H]1OC(C)(C)O[C@H]([C@H](C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C36H51NO7Si/c1-10-24(2)30(38)29(33(39)37-21-22-41-34(37)40)32-26(4)31(43-36(8,9)44-32)25(3)23-42-45(35(5,6)7,27-17-13-11-14-18-27)28-19-15-12-16-20-28/h10-20,24-26,29-32,38H,1,21-23H2,2-9H3/t24-,25+,26+,29-,30-,31+,32+/m0/s1 |
| InChIKey | FKDKVTVURYZMNQ-KGYJJIKDSA-N |
| XLogP | 5.13 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.89 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|