C12H16O2S — CID 134904622
S-phenyl (2S,3R)-3-hydroxy-2-methylpentanethioate (PubChem CID 134904622) has the molecular formula C12H16O2S and a molecular weight of 224.33 g/mol. Its IUPAC name is S-phenyl (2S,3R)-3-hydroxy-2-methylpentanethioate.
| Compound Name | S-phenyl (2S,3R)-3-hydroxy-2-methylpentanethioate |
|---|---|
| PubChem CID | 134904622 |
| Molecular Formula | C12H16O2S |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | S-phenyl (2S,3R)-3-hydroxy-2-methylpentanethioate |
| SMILES | CC[C@@H](O)[C@H](C)C(=O)Sc1ccccc1 |
| InChI | InChI=1S/C12H16O2S/c1-3-11(13)9(2)12(14)15-10-7-5-4-6-8-10/h4-9,11,13H,3H2,1-2H3/t9-,11+/m0/s1 |
| InChIKey | JWWHGIFRJRZBIN-GXSJLCMTSA-N |
| XLogP | 2.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|