C18H30OSi — CID 134906275
(1R,2S,3R,5S)-3-[cyclohexa-2,5-dien-1-yl(dimethyl)silyl]-2-methyl-5-prop-1-en-2-ylcyclohexan-1-ol (PubChem CID 134906275) has the molecular formula C18H30OSi and a molecular weight of 290.52 g/mol. Its IUPAC name is (1R,2S,3R,5S)-3-[cyclohexa-2,5-dien-1-yl(dimethyl)silyl]-2-methyl-5-prop-1-en-2-ylcyclohexan-1-ol.
| Compound Name | (1R,2S,3R,5S)-3-[cyclohexa-2,5-dien-1-yl(dimethyl)silyl]-2-methyl-5-prop-1-en-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 134906275 |
| Molecular Formula | C18H30OSi |
| Molecular Weight | 290.52 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | (1R,2S,3R,5S)-3-[cyclohexa-2,5-dien-1-yl(dimethyl)silyl]-2-methyl-5-prop-1-en-2-ylcyclohexan-1-ol |
| SMILES | C=C(C)[C@H]1C[C@@H](O)[C@H](C)[C@H]([Si](C)(C)C2C=CCC=C2)C1 |
| InChI | InChI=1S/C18H30OSi/c1-13(2)15-11-17(19)14(3)18(12-15)20(4,5)16-9-7-6-8-10-16/h7-10,14-19H,1,6,11-12H2,2-5H3/t14-,15-,17+,18+/m0/s1 |
| InChIKey | HZRJQQKWNAFLMV-CWLKWCNXSA-N |
| XLogP | 4.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.52 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|