C18H17Cl2NO — CID 134907419
(E)-3,4-dichloro-2-(dimethylamino)-1,2-diphenylbut-3-en-1-one (PubChem CID 134907419) has the molecular formula C18H17Cl2NO and a molecular weight of 334.25 g/mol. Its IUPAC name is (E)-3,4-dichloro-2-(dimethylamino)-1,2-diphenylbut-3-en-1-one.
| Compound Name | (E)-3,4-dichloro-2-(dimethylamino)-1,2-diphenylbut-3-en-1-one |
|---|---|
| PubChem CID | 134907419 |
| Molecular Formula | C18H17Cl2NO |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | (E)-3,4-dichloro-2-(dimethylamino)-1,2-diphenylbut-3-en-1-one |
| SMILES | CN(C)C(C(=O)c1ccccc1)(/C(Cl)=C\Cl)c1ccccc1 |
| InChI | InChI=1S/C18H17Cl2NO/c1-21(2)18(16(20)13-19,15-11-7-4-8-12-15)17(22)14-9-5-3-6-10-14/h3-13H,1-2H3/b16-13+ |
| InChIKey | VXOHDHOVKSJNDD-DTQAZKPQSA-N |
| XLogP | 4.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |