C15H10Se2 — CID 134908987
2-methyl-[1]benzoselenolo[2,3-b][1]benzoselenole (PubChem CID 134908987) has the molecular formula C15H10Se2 and a molecular weight of 348.17 g/mol. Its IUPAC name is 2-methyl-[1]benzoselenolo[2,3-b][1]benzoselenole.
| Compound Name | 2-methyl-[1]benzoselenolo[2,3-b][1]benzoselenole |
|---|---|
| PubChem CID | 134908987 |
| Molecular Formula | C15H10Se2 |
| Molecular Weight | 348.17 g/mol |
| Exact Mass | 349.91 |
| IUPAC Name | 2-methyl-[1]benzoselenolo[2,3-b][1]benzoselenole |
| SMILES | Cc1ccc2[se]c3[se]c4ccccc4c3c2c1 |
| InChI | InChI=1S/C15H10Se2/c1-9-6-7-13-11(8-9)14-10-4-2-3-5-12(10)16-15(14)17-13/h2-8H,1H3 |
| InChIKey | RWZVWPQXYWHVIS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.17 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|