C24H20ClNO4S — CID 134911230
[4-[4-(methylamino)phenyl]-2,6-diphenylthiopyran-1-yl] perchlorate (PubChem CID 134911230) has the molecular formula C24H20ClNO4S and a molecular weight of 453.95 g/mol. Its IUPAC name is [4-[4-(methylamino)phenyl]-2,6-diphenylthiopyran-1-yl] perchlorate.
| Compound Name | [4-[4-(methylamino)phenyl]-2,6-diphenylthiopyran-1-yl] perchlorate |
|---|---|
| PubChem CID | 134911230 |
| Molecular Formula | C24H20ClNO4S |
| Molecular Weight | 453.95 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | [4-[4-(methylamino)phenyl]-2,6-diphenylthiopyran-1-yl] perchlorate |
| SMILES | CNc1ccc(C2=CC(c3ccccc3)=S(O[Cl+3]([O-])([O-])[O-])C(c3ccccc3)=C2)cc1 |
| InChI | InChI=1S/C24H20ClNO4S/c1-26-22-14-12-18(13-15-22)21-16-23(19-8-4-2-5-9-19)31(30-25(27,28)29)24(17-21)20-10-6-3-7-11-20/h2-17,26H,1H3 |
| InChIKey | YAQRTKFJTJMNLM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 90.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.95 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|