C41H29ClO4S2 — CID 134911046
[4-[(2,6-diphenylthiopyran-4-ylidene)-phenylmethyl]-2,6-diphenylthiopyran-1-yl] perchlorate (PubChem CID 134911046) has the molecular formula C41H29ClO4S2 and a molecular weight of 685.27 g/mol. Its IUPAC name is [4-[(2,6-diphenylthiopyran-4-ylidene)-phenylmethyl]-2,6-diphenylthiopyran-1-yl] perchlorate.
| Compound Name | [4-[(2,6-diphenylthiopyran-4-ylidene)-phenylmethyl]-2,6-diphenylthiopyran-1-yl] perchlorate |
|---|---|
| PubChem CID | 134911046 |
| Molecular Formula | C41H29ClO4S2 |
| Molecular Weight | 685.27 g/mol |
| Exact Mass | 684.12 |
| IUPAC Name | [4-[(2,6-diphenylthiopyran-4-ylidene)-phenylmethyl]-2,6-diphenylthiopyran-1-yl] perchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])OS1=C(c2ccccc2)C=C(C(=C2C=C(c3ccccc3)SC(c3ccccc3)=C2)c2ccccc2)C=C1c1ccccc1 |
| InChI | InChI=1S/C41H29ClO4S2/c43-42(44,45)46-48-39(32-20-10-3-11-21-32)28-36(29-40(48)33-22-12-4-13-23-33)41(34-24-14-5-15-25-34)35-26-37(30-16-6-1-7-17-30)47-38(27-35)31-18-8-2-9-19-31/h1-29H |
| InChIKey | KONGNAIESMCECT-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 78.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.27 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|