C14H10ClNO4S2 — CID 134909932
(3,5-diphenyl-1,4λ4-dithia-2-azacyclopenta-2,4-dien-4-yl) perchlorate (PubChem CID 134909932) has the molecular formula C14H10ClNO4S2 and a molecular weight of 355.82 g/mol. Its IUPAC name is (3,5-diphenyl-1,4λ4-dithia-2-azacyclopenta-2,4-dien-4-yl) perchlorate.
| Compound Name | (3,5-diphenyl-1,4λ4-dithia-2-azacyclopenta-2,4-dien-4-yl) perchlorate |
|---|---|
| PubChem CID | 134909932 |
| Molecular Formula | C14H10ClNO4S2 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 354.97 |
| IUPAC Name | (3,5-diphenyl-1,4λ4-dithia-2-azacyclopenta-2,4-dien-4-yl) perchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])OS1=C(c2ccccc2)SN=C1c1ccccc1 |
| InChI | InChI=1S/C14H10ClNO4S2/c17-15(18,19)20-22-13(11-7-3-1-4-8-11)16-21-14(22)12-9-5-2-6-10-12/h1-10H |
| InChIKey | QHLMVLRZKPDACL-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 90.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|