C11H14ClN3O4S2 — CID 134909909
[5-(dimethylamino)-3-(N-methylanilino)-1λ4,2-dithia-4-azacyclopenta-3,5-dien-1-yl] perchlorate (PubChem CID 134909909) has the molecular formula C11H14ClN3O4S2 and a molecular weight of 351.84 g/mol. Its IUPAC name is [5-(dimethylamino)-3-(N-methylanilino)-1λ4,2-dithia-4-azacyclopenta-3,5-dien-1-yl] perchlorate.
| Compound Name | [5-(dimethylamino)-3-(N-methylanilino)-1λ4,2-dithia-4-azacyclopenta-3,5-dien-1-yl] perchlorate |
|---|---|
| PubChem CID | 134909909 |
| Molecular Formula | C11H14ClN3O4S2 |
| Molecular Weight | 351.84 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | [5-(dimethylamino)-3-(N-methylanilino)-1λ4,2-dithia-4-azacyclopenta-3,5-dien-1-yl] perchlorate |
| SMILES | CN(C)C1=S(O[Cl+3]([O-])([O-])[O-])SC(N(C)c2ccccc2)=N1 |
| InChI | InChI=1S/C11H14ClN3O4S2/c1-14(2)11-13-10(20-21(11)19-12(16,17)18)15(3)9-7-5-4-6-8-9/h4-8H,1-3H3 |
| InChIKey | PZEQKNYSDXOFRM-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 97.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.84 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|