C17H18ClN3S2 — CID 134909802
3-N-benzyl-1-chloro-5-N,5-N-dimethyl-3-N-phenyl-1λ4,2-dithia-4-azacyclopenta-3,5-diene-3,5-diamine (PubChem CID 134909802) has the molecular formula C17H18ClN3S2 and a molecular weight of 363.94 g/mol. Its IUPAC name is 3-N-benzyl-1-chloro-5-N,5-N-dimethyl-3-N-phenyl-1λ4,2-dithia-4-azacyclopenta-3,5-diene-3,5-diamine.
| Compound Name | 3-N-benzyl-1-chloro-5-N,5-N-dimethyl-3-N-phenyl-1λ4,2-dithia-4-azacyclopenta-3,5-diene-3,5-diamine |
|---|---|
| PubChem CID | 134909802 |
| Molecular Formula | C17H18ClN3S2 |
| Molecular Weight | 363.94 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 3-N-benzyl-1-chloro-5-N,5-N-dimethyl-3-N-phenyl-1λ4,2-dithia-4-azacyclopenta-3,5-diene-3,5-diamine |
| SMILES | CN(C)C1=S(Cl)SC(N(Cc2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C17H18ClN3S2/c1-20(2)17-19-16(22-23(17)18)21(15-11-7-4-8-12-15)13-14-9-5-3-6-10-14/h3-12H,13H2,1-2H3 |
| InChIKey | GJFJVHVXGLPTHR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.94 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|