C15H11I3S2 — CID 134908547
(3,5-diphenyl-1λ4,2-dithiacyclopenta-3,5-dien-1-yl)-diiodo-λ3-iodane (PubChem CID 134908547) has the molecular formula C15H11I3S2 and a molecular weight of 636.10 g/mol. Its IUPAC name is (3,5-diphenyl-1λ4,2-dithiacyclopenta-3,5-dien-1-yl)-diiodo-λ3-iodane.
| Compound Name | (3,5-diphenyl-1λ4,2-dithiacyclopenta-3,5-dien-1-yl)-diiodo-λ3-iodane |
|---|---|
| PubChem CID | 134908547 |
| Molecular Formula | C15H11I3S2 |
| Molecular Weight | 636.10 g/mol |
| Exact Mass | 635.74 |
| IUPAC Name | (3,5-diphenyl-1λ4,2-dithiacyclopenta-3,5-dien-1-yl)-diiodo-λ3-iodane |
| SMILES | II(I)S1=C(c2ccccc2)C=C(c2ccccc2)S1 |
| InChI | InChI=1S/C15H11I3S2/c16-18(17)20-15(13-9-5-2-6-10-13)11-14(19-20)12-7-3-1-4-8-12/h1-11H |
| InChIKey | GPHUVRUOWVYMQV-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.10 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|