C18H14OS2 — CID 628245
3-methyl-4,7-diphenyl-2-oxa-1lambda4,8-dithiabicyclo[3.3.0]octa-1(5),3,6-triene (PubChem CID 628245) has the molecular formula C18H14OS2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 3-methyl-4,7-diphenyl-2-oxa-1lambda4,8-dithiabicyclo[3.3.0]octa-1(5),3,6-triene.
| Compound Name | 3-methyl-4,7-diphenyl-2-oxa-1lambda4,8-dithiabicyclo[3.3.0]octa-1(5),3,6-triene |
|---|---|
| PubChem CID | 628245 |
| Molecular Formula | C18H14OS2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 3-methyl-4,7-diphenyl-2-oxa-1lambda4,8-dithiabicyclo[3.3.0]octa-1(5),3,6-triene |
| SMILES | CC1=C(c2ccccc2)C2=S(O1)SC(c1ccccc1)=C2 |
| InChI | InChI=1S/C18H14OS2/c1-13-18(15-10-6-3-7-11-15)17-12-16(20-21(17)19-13)14-8-4-2-5-9-14/h2-12H,1H3 |
| InChIKey | OFENEPDDKGGYNE-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|