C17H10Cl2S3 — CID 11014411
4-chloro-3-(4-chlorophenyl)-7-phenyl-1λ4,2,8-trithiabicyclo[3.3.0]octa-1(5),3,6-triene (PubChem CID 11014411) has the molecular formula C17H10Cl2S3 and a molecular weight of 381.37 g/mol. Its IUPAC name is 4-chloro-3-(4-chlorophenyl)-7-phenyl-1λ4,2,8-trithiabicyclo[3.3.0]octa-1(5),3,6-triene.
| Compound Name | 4-chloro-3-(4-chlorophenyl)-7-phenyl-1λ4,2,8-trithiabicyclo[3.3.0]octa-1(5),3,6-triene |
|---|---|
| PubChem CID | 11014411 |
| Molecular Formula | C17H10Cl2S3 |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 379.93 |
| IUPAC Name | 4-chloro-3-(4-chlorophenyl)-7-phenyl-1λ4,2,8-trithiabicyclo[3.3.0]octa-1(5),3,6-triene |
| SMILES | ClC1=C(c2ccc(Cl)cc2)SS2=C1C=C(c1ccccc1)S2 |
| InChI | InChI=1S/C17H10Cl2S3/c18-13-8-6-12(7-9-13)17-16(19)15-10-14(20-22(15)21-17)11-4-2-1-3-5-11/h1-10H |
| InChIKey | UDAGQPXXGWRKOR-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|