C10H8BrClS2 — CID 11370259
5-bromo-6-(4-chlorophenyl)-2,3-dihydro-1,4-dithiine (PubChem CID 11370259) has the molecular formula C10H8BrClS2 and a molecular weight of 307.67 g/mol. Its IUPAC name is 5-bromo-6-(4-chlorophenyl)-2,3-dihydro-1,4-dithiine.
| Compound Name | 5-bromo-6-(4-chlorophenyl)-2,3-dihydro-1,4-dithiine |
|---|---|
| PubChem CID | 11370259 |
| Molecular Formula | C10H8BrClS2 |
| Molecular Weight | 307.67 g/mol |
| Exact Mass | 305.89 |
| IUPAC Name | 5-bromo-6-(4-chlorophenyl)-2,3-dihydro-1,4-dithiine |
| SMILES | Clc1ccc(C2=C(Br)SCCS2)cc1 |
| InChI | InChI=1S/C10H8BrClS2/c11-10-9(13-5-6-14-10)7-1-3-8(12)4-2-7/h1-4H,5-6H2 |
| InChIKey | ILIXRWOVGXSIFZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.67 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |