C10H9BrS2 — CID 11414632
5-bromo-6-phenyl-2,3-dihydro-1,4-dithiine (PubChem CID 11414632) has the molecular formula C10H9BrS2 and a molecular weight of 273.22 g/mol. Its IUPAC name is 5-bromo-6-phenyl-2,3-dihydro-1,4-dithiine.
| Compound Name | 5-bromo-6-phenyl-2,3-dihydro-1,4-dithiine |
|---|---|
| PubChem CID | 11414632 |
| Molecular Formula | C10H9BrS2 |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 271.93 |
| IUPAC Name | 5-bromo-6-phenyl-2,3-dihydro-1,4-dithiine |
| SMILES | BrC1=C(c2ccccc2)SCCS1 |
| InChI | InChI=1S/C10H9BrS2/c11-10-9(12-6-7-13-10)8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | NUCUEGQEJGMJGJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |