C16H12ClIS3 — CID 135051575
3-(4-chlorophenyl)-1-iodo-5-methylsulfanyl-4-phenyl-1λ4,2-dithiacyclopenta-3,5-diene (PubChem CID 135051575) has the molecular formula C16H12ClIS3 and a molecular weight of 462.83 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-iodo-5-methylsulfanyl-4-phenyl-1λ4,2-dithiacyclopenta-3,5-diene.
| Compound Name | 3-(4-chlorophenyl)-1-iodo-5-methylsulfanyl-4-phenyl-1λ4,2-dithiacyclopenta-3,5-diene |
|---|---|
| PubChem CID | 135051575 |
| Molecular Formula | C16H12ClIS3 |
| Molecular Weight | 462.83 g/mol |
| Exact Mass | 461.88 |
| IUPAC Name | 3-(4-chlorophenyl)-1-iodo-5-methylsulfanyl-4-phenyl-1λ4,2-dithiacyclopenta-3,5-diene |
| SMILES | CSC1=S(I)SC(c2ccc(Cl)cc2)=C1c1ccccc1 |
| InChI | InChI=1S/C16H12ClIS3/c1-19-16-14(11-5-3-2-4-6-11)15(20-21(16)18)12-7-9-13(17)10-8-12/h2-10H,1H3 |
| InChIKey | CMGRNZSOGRLGPF-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.83 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|