C17H15IOS3 — CID 135051305
1-iodo-3-(4-methoxyphenyl)-5-methylsulfanyl-4-phenyl-1λ4,2-dithiacyclopenta-3,5-diene (PubChem CID 135051305) has the molecular formula C17H15IOS3 and a molecular weight of 458.41 g/mol. Its IUPAC name is 1-iodo-3-(4-methoxyphenyl)-5-methylsulfanyl-4-phenyl-1λ4,2-dithiacyclopenta-3,5-diene.
| Compound Name | 1-iodo-3-(4-methoxyphenyl)-5-methylsulfanyl-4-phenyl-1λ4,2-dithiacyclopenta-3,5-diene |
|---|---|
| PubChem CID | 135051305 |
| Molecular Formula | C17H15IOS3 |
| Molecular Weight | 458.41 g/mol |
| Exact Mass | 457.93 |
| IUPAC Name | 1-iodo-3-(4-methoxyphenyl)-5-methylsulfanyl-4-phenyl-1λ4,2-dithiacyclopenta-3,5-diene |
| SMILES | COc1ccc(C2=C(c3ccccc3)C(SC)=S(I)S2)cc1 |
| InChI | InChI=1S/C17H15IOS3/c1-19-14-10-8-13(9-11-14)16-15(12-6-4-3-5-7-12)17(20-2)22(18)21-16/h3-11H,1-2H3 |
| InChIKey | ORKBFNAYXNMCMF-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.41 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|