C24H18OS4 — CID 135051492
(9Z)-4-phenyl-9-(5-phenyldithiol-3-ylidene)-5-oxa-6λ4,7-dithiatricyclo[6.4.0.02,6]dodeca-1(8),2(6),3-triene (PubChem CID 135051492) has the molecular formula C24H18OS4 and a molecular weight of 450.68 g/mol. Its IUPAC name is (9Z)-4-phenyl-9-(5-phenyldithiol-3-ylidene)-5-oxa-6λ4,7-dithiatricyclo[6.4.0.02,6]dodeca-1(8),2(6),3-triene.
| Compound Name | (9Z)-4-phenyl-9-(5-phenyldithiol-3-ylidene)-5-oxa-6λ4,7-dithiatricyclo[6.4.0.02,6]dodeca-1(8),2(6),3-triene |
|---|---|
| PubChem CID | 135051492 |
| Molecular Formula | C24H18OS4 |
| Molecular Weight | 450.68 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | (9Z)-4-phenyl-9-(5-phenyldithiol-3-ylidene)-5-oxa-6λ4,7-dithiatricyclo[6.4.0.02,6]dodeca-1(8),2(6),3-triene |
| SMILES | C1=C(c2ccccc2)OS2=C1C1=C(S2)/C(=C2/C=C(c3ccccc3)SS2)CCC1 |
| InChI | InChI=1S/C24H18OS4/c1-3-8-16(9-4-1)20-14-23-19-13-7-12-18(24(19)28-29(23)25-20)22-15-21(26-27-22)17-10-5-2-6-11-17/h1-6,8-11,14-15H,7,12-13H2/b22-18- |
| InChIKey | OCAMYZHSXGTBJH-PYCFMQQDSA-N |
| XLogP | 8.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.68 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|