About 2-iodo-5-phenyl-1,3-thiaselenol-2-amine
2-iodo-5-phenyl-1,3-thiaselenol-2-amine (PubChem CID 134938444) has the molecular formula C9H8INSSe
and a molecular weight of 368.10 g/mol. Its IUPAC name is 2-iodo-5-phenyl-1,3-thiaselenol-2-amine.
Molecular Properties
| Compound Name | 2-iodo-5-phenyl-1,3-thiaselenol-2-amine |
| PubChem CID | 134938444 |
| Molecular Formula | C9H8INSSe |
| Molecular Weight | 368.10 g/mol |
| Exact Mass | 368.86 |
| IUPAC Name | 2-iodo-5-phenyl-1,3-thiaselenol-2-amine |
| SMILES | NC1(I)SC(c2ccccc2)=C[Se]1 |
| InChI | InChI=1S/C9H8INSSe/c10-9(11)12-8(6-13-9)7-4-2-1-3-5-7/h1-6H,11H2 |
| InChIKey | QXKSTRHULLVSEC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.10 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-5-phenyl-1,3-thiaselenol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-5-phenyl-1,3-thiaselenol-2-amine?
The IUPAC name of 2-iodo-5-phenyl-1,3-thiaselenol-2-amine (CID 134938444) is 2-iodo-5-phenyl-1,3-thiaselenol-2-amine.
What is the SMILES notation for 2-iodo-5-phenyl-1,3-thiaselenol-2-amine?
The canonical SMILES for 2-iodo-5-phenyl-1,3-thiaselenol-2-amine is NC1(I)SC(c2ccccc2)=C[Se]1.
What is the InChIKey of 2-iodo-5-phenyl-1,3-thiaselenol-2-amine?
The InChIKey is QXKSTRHULLVSEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8INSSe/c10-9(11)12-8(6-13-9)7-4-2-1-3-5-7/h1-6H,11H2.
What are the key properties of 2-iodo-5-phenyl-1,3-thiaselenol-2-amine?
2-iodo-5-phenyl-1,3-thiaselenol-2-amine has a molecular weight of 368.10 g/mol, XLogP of 2.44, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-5-phenyl-1,3-thiaselenol-2-amine is sourced from PubChem (CID 134938444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).