C17H15ClO4S2 — CID 134908943
[3,5-bis(4-methylphenyl)-1λ4,2-dithiacyclopenta-3,5-dien-1-yl] perchlorate (PubChem CID 134908943) has the molecular formula C17H15ClO4S2 and a molecular weight of 382.89 g/mol. Its IUPAC name is [3,5-bis(4-methylphenyl)-1λ4,2-dithiacyclopenta-3,5-dien-1-yl] perchlorate.
| Compound Name | [3,5-bis(4-methylphenyl)-1λ4,2-dithiacyclopenta-3,5-dien-1-yl] perchlorate |
|---|---|
| PubChem CID | 134908943 |
| Molecular Formula | C17H15ClO4S2 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.01 |
| IUPAC Name | [3,5-bis(4-methylphenyl)-1λ4,2-dithiacyclopenta-3,5-dien-1-yl] perchlorate |
| SMILES | Cc1ccc(C2=CC(c3ccc(C)cc3)=S(O[Cl+3]([O-])([O-])[O-])S2)cc1 |
| InChI | InChI=1S/C17H15ClO4S2/c1-12-3-7-14(8-4-12)16-11-17(15-9-5-13(2)6-10-15)24(23-16)22-18(19,20)21/h3-11H,1-2H3 |
| InChIKey | KBSHHAYLOSOSDD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 78.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|