C35H25ClO4SSe — CID 134910980
[4-[(2,6-diphenylthiopyran-4-ylidene)methyl]-2,6-diphenylselenopyran-1-yl] perchlorate (PubChem CID 134910980) has the molecular formula C35H25ClO4SSe and a molecular weight of 656.06 g/mol. Its IUPAC name is [4-[(2,6-diphenylthiopyran-4-ylidene)methyl]-2,6-diphenylselenopyran-1-yl] perchlorate.
| Compound Name | [4-[(2,6-diphenylthiopyran-4-ylidene)methyl]-2,6-diphenylselenopyran-1-yl] perchlorate |
|---|---|
| PubChem CID | 134910980 |
| Molecular Formula | C35H25ClO4SSe |
| Molecular Weight | 656.06 g/mol |
| Exact Mass | 656.03 |
| IUPAC Name | [4-[(2,6-diphenylthiopyran-4-ylidene)methyl]-2,6-diphenylselenopyran-1-yl] perchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])O[Se]1=C(c2ccccc2)C=C(C=C2C=C(c3ccccc3)SC(c3ccccc3)=C2)C=C1c1ccccc1 |
| InChI | InChI=1S/C35H25ClO4SSe/c37-36(38,39)40-42-34(30-17-9-3-10-18-30)24-27(25-35(42)31-19-11-4-12-20-31)21-26-22-32(28-13-5-1-6-14-28)41-33(23-26)29-15-7-2-8-16-29/h1-25H |
| InChIKey | NHQPJENQEVGUGD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 78.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.06 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|