C35H25ClO4Se2 — CID 134911521
[2-phenyl-4-[(1E,3E,5E)-5-(2-phenylselenochromen-4-ylidene)penta-1,3-dienyl]selenochromen-1-yl] perchlorate (PubChem CID 134911521) has the molecular formula C35H25ClO4Se2 and a molecular weight of 702.95 g/mol. Its IUPAC name is [2-phenyl-4-[(1E,3E,5E)-5-(2-phenylselenochromen-4-ylidene)penta-1,3-dienyl]selenochromen-1-yl] perchlorate.
| Compound Name | [2-phenyl-4-[(1E,3E,5E)-5-(2-phenylselenochromen-4-ylidene)penta-1,3-dienyl]selenochromen-1-yl] perchlorate |
|---|---|
| PubChem CID | 134911521 |
| Molecular Formula | C35H25ClO4Se2 |
| Molecular Weight | 702.95 g/mol |
| Exact Mass | 703.98 |
| IUPAC Name | [2-phenyl-4-[(1E,3E,5E)-5-(2-phenylselenochromen-4-ylidene)penta-1,3-dienyl]selenochromen-1-yl] perchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])O[Se]1=C(c2ccccc2)C=C(/C=C/C=C/C=C2\C=C(c3ccccc3)[Se]c3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C35H25ClO4Se2/c37-36(38,39)40-42-34-23-13-11-21-31(34)29(25-35(42)27-16-6-2-7-17-27)19-9-3-8-18-28-24-33(26-14-4-1-5-15-26)41-32-22-12-10-20-30(28)32/h1-25H/b8-3+,19-9+,28-18+ |
| InChIKey | SIDVBXBZDSOUQV-MDPXONLVSA-N |
| XLogP | 2.58 |
| TPSA | 78.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.95 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|