C25H28N2O — CID 13491216
7-methoxy-3-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-2,3,4,9-tetrahydro-1H-carbazole (PubChem CID 13491216) has the molecular formula C25H28N2O and a molecular weight of 372.51 g/mol. Its IUPAC name is 7-methoxy-3-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-2,3,4,9-tetrahydro-1H-carbazole.
| Compound Name | 7-methoxy-3-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-2,3,4,9-tetrahydro-1H-carbazole |
|---|---|
| PubChem CID | 13491216 |
| Molecular Formula | C25H28N2O |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 7-methoxy-3-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-2,3,4,9-tetrahydro-1H-carbazole |
| SMILES | COc1ccc2c3c([nH]c2c1)CCC(CN1CC=C(c2ccccc2)CC1)C3 |
| InChI | InChI=1S/C25H28N2O/c1-28-21-8-9-22-23-15-18(7-10-24(23)26-25(22)16-21)17-27-13-11-20(12-14-27)19-5-3-2-4-6-19/h2-6,8-9,11,16,18,26H,7,10,12-15,17H2,1H3 |
| InChIKey | DAKHDSORNOHKGE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|