C14H15NO2 — CID 87746150
7-methoxy-2,3,4,9-tetrahydro-1H-carbazole-3-carbaldehyde (PubChem CID 87746150) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 7-methoxy-2,3,4,9-tetrahydro-1H-carbazole-3-carbaldehyde.
| Compound Name | 7-methoxy-2,3,4,9-tetrahydro-1H-carbazole-3-carbaldehyde |
|---|---|
| PubChem CID | 87746150 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 7-methoxy-2,3,4,9-tetrahydro-1H-carbazole-3-carbaldehyde |
| SMILES | COc1ccc2c3c([nH]c2c1)CCC(C=O)C3 |
| InChI | InChI=1S/C14H15NO2/c1-17-10-3-4-11-12-6-9(8-16)2-5-13(12)15-14(11)7-10/h3-4,7-9,15H,2,5-6H2,1H3 |
| InChIKey | ACFLOBUYDXZEFE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|