C20H30O7 — CID 134917555
(5-methyl-2-propan-2-ylcyclohexyl) (1S,2S,6S,7R)-4,4-dimethyl-9-oxo-3,5,8,11-tetraoxatricyclo[5.3.1.02,6]undecane-10-carboxylate (PubChem CID 134917555) has the molecular formula C20H30O7 and a molecular weight of 382.45 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) (1S,2S,6S,7R)-4,4-dimethyl-9-oxo-3,5,8,11-tetraoxatricyclo[5.3.1.02,6]undecane-10-carboxylate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) (1S,2S,6S,7R)-4,4-dimethyl-9-oxo-3,5,8,11-tetraoxatricyclo[5.3.1.02,6]undecane-10-carboxylate |
|---|---|
| PubChem CID | 134917555 |
| Molecular Formula | C20H30O7 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) (1S,2S,6S,7R)-4,4-dimethyl-9-oxo-3,5,8,11-tetraoxatricyclo[5.3.1.02,6]undecane-10-carboxylate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)C2C(=O)O[C@H]3O[C@@H]2[C@@H]2OC(C)(C)O[C@H]32)C1 |
| InChI | InChI=1S/C20H30O7/c1-9(2)11-7-6-10(3)8-12(11)23-17(21)13-14-15-16(27-20(4,5)26-15)19(24-14)25-18(13)22/h9-16,19H,6-8H2,1-5H3/t10?,11?,12?,13?,14-,15-,16-,19+/m0/s1 |
| InChIKey | IHZBAXKELVGKTH-LMDIOSFKSA-N |
| XLogP | 2.41 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|