C23H34O12 — CID 11260589
ethyl (1S,2R,3R,4R,6R)-6-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,3,4-triacetyloxycyclohexane-1-carboxylate (PubChem CID 11260589) has the molecular formula C23H34O12 and a molecular weight of 502.51 g/mol. Its IUPAC name is ethyl (1S,2R,3R,4R,6R)-6-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,3,4-triacetyloxycyclohexane-1-carboxylate.
| Compound Name | ethyl (1S,2R,3R,4R,6R)-6-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,3,4-triacetyloxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 11260589 |
| Molecular Formula | C23H34O12 |
| Molecular Weight | 502.51 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | ethyl (1S,2R,3R,4R,6R)-6-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,3,4-triacetyloxycyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H]([C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]2OC)C[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H34O12/c1-8-29-21(27)15-13(16-19(28-7)20-22(33-16)35-23(5,6)34-20)9-14(30-10(2)24)17(31-11(3)25)18(15)32-12(4)26/h13-20,22H,8-9H2,1-7H3/t13-,14-,15+,16-,17-,18-,19+,20-,22-/m1/s1 |
| InChIKey | YNEWMEQLIMYFKA-FCJXDTKYSA-N |
| XLogP | 0.87 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.51 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|