C26H40O12 — CID 23265164
tetraethyl 2-[(3aR,5R,6S,6aR)-6-methoxyspiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-5-yl]propane-1,1,3,3-tetracarboxylate (PubChem CID 23265164) has the molecular formula C26H40O12 and a molecular weight of 544.59 g/mol. Its IUPAC name is tetraethyl 2-[(3aR,5R,6S,6aR)-6-methoxyspiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-5-yl]propane-1,1,3,3-tetracarboxylate.
| Compound Name | tetraethyl 2-[(3aR,5R,6S,6aR)-6-methoxyspiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-5-yl]propane-1,1,3,3-tetracarboxylate |
|---|---|
| PubChem CID | 23265164 |
| Molecular Formula | C26H40O12 |
| Molecular Weight | 544.59 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | tetraethyl 2-[(3aR,5R,6S,6aR)-6-methoxyspiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-5-yl]propane-1,1,3,3-tetracarboxylate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(C(C(=O)OCC)C(=O)OCC)[C@H]1O[C@@H]2OC3(CCCCC3)O[C@@H]2[C@H]1OC |
| InChI | InChI=1S/C26H40O12/c1-6-32-21(27)16(22(28)33-7-2)15(17(23(29)34-8-3)24(30)35-9-4)18-19(31-5)20-25(36-18)38-26(37-20)13-11-10-12-14-26/h15-20,25H,6-14H2,1-5H3/t18-,19+,20-,25-/m1/s1 |
| InChIKey | MMRRRAVGBUHYKR-XZWCOCNFSA-N |
| XLogP | 1.90 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.59 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|