C19H30N2O9 — CID 134920185
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(2-methylpropyliminomethylamino)oxan-2-yl]methyl acetate (PubChem CID 134920185) has the molecular formula C19H30N2O9 and a molecular weight of 430.45 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(2-methylpropyliminomethylamino)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(2-methylpropyliminomethylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134920185 |
| Molecular Formula | C19H30N2O9 |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(2-methylpropyliminomethylamino)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](N/C=N/CC(C)C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H30N2O9/c1-10(2)7-20-9-21-19-18(29-14(6)25)17(28-13(5)24)16(27-12(4)23)15(30-19)8-26-11(3)22/h9-10,15-19H,7-8H2,1-6H3,(H,20,21)/t15-,16-,17+,18-,19-/m1/s1 |
| InChIKey | DJNYHVAQZCFHDY-UJWQCDCRSA-N |
| XLogP | 0.34 |
| TPSA | 138.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|