C23H21Cl2N2+ — CID 134921428
(4-chloro-N-(1-chloro-2,2-diphenylethenyl)anilino)methylidene-dimethylazanium (PubChem CID 134921428) has the molecular formula C23H21Cl2N2+ and a molecular weight of 396.34 g/mol. Its IUPAC name is (4-chloro-N-(1-chloro-2,2-diphenylethenyl)anilino)methylidene-dimethylazanium.
| Compound Name | (4-chloro-N-(1-chloro-2,2-diphenylethenyl)anilino)methylidene-dimethylazanium |
|---|---|
| PubChem CID | 134921428 |
| Molecular Formula | C23H21Cl2N2+ |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | (4-chloro-N-(1-chloro-2,2-diphenylethenyl)anilino)methylidene-dimethylazanium |
| SMILES | C[N+](C)=CN(C(Cl)=C(c1ccccc1)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H21Cl2N2/c1-26(2)17-27(21-15-13-20(24)14-16-21)23(25)22(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-17H,1-2H3/q+1 |
| InChIKey | VXPVYMLLXAJLMC-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|