About N-(1-chloro-2,2-diphenylethenyl)-N-phenylformamide
N-(1-chloro-2,2-diphenylethenyl)-N-phenylformamide (PubChem CID 71334074) has the molecular formula C21H16ClNO
and a molecular weight of 333.82 g/mol. Its IUPAC name is N-(1-chloro-2,2-diphenylethenyl)-N-phenylformamide.
Molecular Properties
| Compound Name | N-(1-chloro-2,2-diphenylethenyl)-N-phenylformamide |
| PubChem CID | 71334074 |
| Molecular Formula | C21H16ClNO |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | N-(1-chloro-2,2-diphenylethenyl)-N-phenylformamide |
| SMILES | O=CN(C(Cl)=C(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H16ClNO/c22-21(23(16-24)19-14-8-3-9-15-19)20(17-10-4-1-5-11-17)18-12-6-2-7-13-18/h1-16H |
| InChIKey | UYQVZMCFSLHQAC-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(1-chloro-2,2-diphenylethenyl)-N-phenylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-chloro-2,2-diphenylethenyl)-N-phenylformamide?
The IUPAC name of N-(1-chloro-2,2-diphenylethenyl)-N-phenylformamide (CID 71334074) is N-(1-chloro-2,2-diphenylethenyl)-N-phenylformamide.
What is the SMILES notation for N-(1-chloro-2,2-diphenylethenyl)-N-phenylformamide?
The canonical SMILES for N-(1-chloro-2,2-diphenylethenyl)-N-phenylformamide is O=CN(C(Cl)=C(c1ccccc1)c1ccccc1)c1ccccc1.
What is the InChIKey of N-(1-chloro-2,2-diphenylethenyl)-N-phenylformamide?
The InChIKey is UYQVZMCFSLHQAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16ClNO/c22-21(23(16-24)19-14-8-3-9-15-19)20(17-10-4-1-5-11-17)18-12-6-2-7-13-18/h1-16H.
What are the key properties of N-(1-chloro-2,2-diphenylethenyl)-N-phenylformamide?
N-(1-chloro-2,2-diphenylethenyl)-N-phenylformamide has a molecular weight of 333.82 g/mol, XLogP of 5.31, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-chloro-2,2-diphenylethenyl)-N-phenylformamide is sourced from PubChem (CID 71334074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).