C28H21NO5 — CID 174668651
1,2-diphenylethane-1,2-dione;2-oxo-2-(N-phenylanilino)acetic acid (PubChem CID 174668651) has the molecular formula C28H21NO5 and a molecular weight of 451.48 g/mol. Its IUPAC name is 1,2-diphenylethane-1,2-dione;2-oxo-2-(N-phenylanilino)acetic acid.
| Compound Name | 1,2-diphenylethane-1,2-dione;2-oxo-2-(N-phenylanilino)acetic acid |
|---|---|
| PubChem CID | 174668651 |
| Molecular Formula | C28H21NO5 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 1,2-diphenylethane-1,2-dione;2-oxo-2-(N-phenylanilino)acetic acid |
| SMILES | O=C(C(=O)c1ccccc1)c1ccccc1.O=C(O)C(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H11NO3.C14H10O2/c16-13(14(17)18)15(11-7-3-1-4-8-11)12-9-5-2-6-10-12;15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10H,(H,17,18);1-10H |
| InChIKey | DKSGLMDRCUPSFD-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|