C15H12BrNO — CID 15519224
2-bromo-N,N-diphenylprop-2-enamide (PubChem CID 15519224) has the molecular formula C15H12BrNO and a molecular weight of 302.17 g/mol. Its IUPAC name is 2-bromo-N,N-diphenylprop-2-enamide.
| Compound Name | 2-bromo-N,N-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 15519224 |
| Molecular Formula | C15H12BrNO |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | 2-bromo-N,N-diphenylprop-2-enamide |
| SMILES | C=C(Br)C(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H12BrNO/c1-12(16)15(18)17(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11H,1H2 |
| InChIKey | BGXYNHAYFCWYEL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|