C24H25NO3 — CID 134921917
(1R,5S,7S)-7-(4-nitrophenyl)-1-[(E)-5-phenylpent-4-enyl]bicyclo[3.1.1]heptan-6-one (PubChem CID 134921917) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is (1R,5S,7S)-7-(4-nitrophenyl)-1-[(E)-5-phenylpent-4-enyl]bicyclo[3.1.1]heptan-6-one.
| Compound Name | (1R,5S,7S)-7-(4-nitrophenyl)-1-[(E)-5-phenylpent-4-enyl]bicyclo[3.1.1]heptan-6-one |
|---|---|
| PubChem CID | 134921917 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (1R,5S,7S)-7-(4-nitrophenyl)-1-[(E)-5-phenylpent-4-enyl]bicyclo[3.1.1]heptan-6-one |
| SMILES | O=C1[C@H]2CCC[C@]1(CCC/C=C/c1ccccc1)[C@@H]2c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H25NO3/c26-23-21-11-7-17-24(23,16-6-2-5-10-18-8-3-1-4-9-18)22(21)19-12-14-20(15-13-19)25(27)28/h1,3-5,8-10,12-15,21-22H,2,6-7,11,16-17H2/b10-5+/t21-,22+,24+/m0/s1 |
| InChIKey | DBUYEIVOHSUHEO-VLBLUZLQSA-N |
| XLogP | 5.93 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|