C21H34O5 — CID 134922551
ditert-butyl (1S,2S,3E)-10-oxocycloundec-3-ene-1,2-dicarboxylate (PubChem CID 134922551) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is ditert-butyl (1S,2S,3E)-10-oxocycloundec-3-ene-1,2-dicarboxylate.
| Compound Name | ditert-butyl (1S,2S,3E)-10-oxocycloundec-3-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 134922551 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | ditert-butyl (1S,2S,3E)-10-oxocycloundec-3-ene-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1/C=C/CCCCCC(=O)C[C@@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H34O5/c1-20(2,3)25-18(23)16-13-11-9-7-8-10-12-15(22)14-17(16)19(24)26-21(4,5)6/h11,13,16-17H,7-10,12,14H2,1-6H3/b13-11+/t16-,17-/m0/s1 |
| InChIKey | HWMGKVAPEYLMIN-NSNJOPQOSA-N |
| XLogP | 4.38 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|