C20H35NO2Si — CID 134924167
[(3S,5R)-2-benzyl-3-tert-butyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 134924167) has the molecular formula C20H35NO2Si and a molecular weight of 349.59 g/mol. Its IUPAC name is [(3S,5R)-2-benzyl-3-tert-butyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3S,5R)-2-benzyl-3-tert-butyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134924167 |
| Molecular Formula | C20H35NO2Si |
| Molecular Weight | 349.59 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | [(3S,5R)-2-benzyl-3-tert-butyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)ON1Cc1ccccc1 |
| InChI | InChI=1S/C20H35NO2Si/c1-19(2,3)17-14-18(23-24(7,8)20(4,5)6)22-21(17)15-16-12-10-9-11-13-16/h9-13,17-18H,14-15H2,1-8H3/t17-,18+/m0/s1 |
| InChIKey | ASJSTDACFHAYCV-ZWKOTPCHSA-N |
| XLogP | 5.59 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.59 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|