C21H35NO2Si — CID 102461678
N-benzyl-N-[6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-4-yn-3-yl]hydroxylamine (PubChem CID 102461678) has the molecular formula C21H35NO2Si and a molecular weight of 361.60 g/mol. Its IUPAC name is N-benzyl-N-[6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-4-yn-3-yl]hydroxylamine.
| Compound Name | N-benzyl-N-[6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-4-yn-3-yl]hydroxylamine |
|---|---|
| PubChem CID | 102461678 |
| Molecular Formula | C21H35NO2Si |
| Molecular Weight | 361.60 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | N-benzyl-N-[6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylhex-4-yn-3-yl]hydroxylamine |
| SMILES | CC(C)(C)C(C#CCO[Si](C)(C)C(C)(C)C)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C21H35NO2Si/c1-20(2,3)19(22(23)17-18-13-10-9-11-14-18)15-12-16-24-25(7,8)21(4,5)6/h9-11,13-14,19,23H,16-17H2,1-8H3 |
| InChIKey | ZMDBAQHTQUTCMA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.60 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|