C20H33NO2Si — CID 102461683
(2-benzyl-3-propan-2-yl-3H-1,2-oxazol-5-yl)methoxy-tert-butyl-dimethylsilane (PubChem CID 102461683) has the molecular formula C20H33NO2Si and a molecular weight of 347.57 g/mol. Its IUPAC name is (2-benzyl-3-propan-2-yl-3H-1,2-oxazol-5-yl)methoxy-tert-butyl-dimethylsilane.
| Compound Name | (2-benzyl-3-propan-2-yl-3H-1,2-oxazol-5-yl)methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 102461683 |
| Molecular Formula | C20H33NO2Si |
| Molecular Weight | 347.57 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | (2-benzyl-3-propan-2-yl-3H-1,2-oxazol-5-yl)methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)C1C=C(CO[Si](C)(C)C(C)(C)C)ON1Cc1ccccc1 |
| InChI | InChI=1S/C20H33NO2Si/c1-16(2)19-13-18(15-22-24(6,7)20(3,4)5)23-21(19)14-17-11-9-8-10-12-17/h8-13,16,19H,14-15H2,1-7H3 |
| InChIKey | QDROLWVAAGWMMB-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.57 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|