C21H37NO2Si — CID 134924168
[(3R,5R)-2-benzyl-3-tert-butyl-5-methyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 134924168) has the molecular formula C21H37NO2Si and a molecular weight of 363.62 g/mol. Its IUPAC name is [(3R,5R)-2-benzyl-3-tert-butyl-5-methyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3R,5R)-2-benzyl-3-tert-butyl-5-methyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134924168 |
| Molecular Formula | C21H37NO2Si |
| Molecular Weight | 363.62 g/mol |
| Exact Mass | 363.26 |
| IUPAC Name | [(3R,5R)-2-benzyl-3-tert-butyl-5-methyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[C@H]1C[C@@](C)(O[Si](C)(C)C(C)(C)C)ON1Cc1ccccc1 |
| InChI | InChI=1S/C21H37NO2Si/c1-19(2,3)18-15-21(7,24-25(8,9)20(4,5)6)23-22(18)16-17-13-11-10-12-14-17/h10-14,18H,15-16H2,1-9H3/t18-,21-/m1/s1 |
| InChIKey | PGKSWJGZWFABNX-WIYYLYMNSA-N |
| XLogP | 5.98 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.62 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|