C11H22O2 — CID 134924643
5-hydroxy-2,2,5,6-tetramethylheptan-3-one (PubChem CID 134924643) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is 5-hydroxy-2,2,5,6-tetramethylheptan-3-one.
| Compound Name | 5-hydroxy-2,2,5,6-tetramethylheptan-3-one |
|---|---|
| PubChem CID | 134924643 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 5-hydroxy-2,2,5,6-tetramethylheptan-3-one |
| SMILES | CC(C)C(C)(O)CC(=O)C(C)(C)C |
| InChI | InChI=1S/C11H22O2/c1-8(2)11(6,13)7-9(12)10(3,4)5/h8,13H,7H2,1-6H3 |
| InChIKey | VFNRNKBCWGMSSZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |