C17H35NO — CID 144923791
7-(dimethylamino)-2,2,5,5,7,8-hexamethylnonan-3-one (PubChem CID 144923791) has the molecular formula C17H35NO and a molecular weight of 269.47 g/mol. Its IUPAC name is 7-(dimethylamino)-2,2,5,5,7,8-hexamethylnonan-3-one.
| Compound Name | 7-(dimethylamino)-2,2,5,5,7,8-hexamethylnonan-3-one |
|---|---|
| PubChem CID | 144923791 |
| Molecular Formula | C17H35NO |
| Molecular Weight | 269.47 g/mol |
| Exact Mass | 269.27 |
| IUPAC Name | 7-(dimethylamino)-2,2,5,5,7,8-hexamethylnonan-3-one |
| SMILES | CC(C)C(C)(CC(C)(C)CC(=O)C(C)(C)C)N(C)C |
| InChI | InChI=1S/C17H35NO/c1-13(2)17(8,18(9)10)12-16(6,7)11-14(19)15(3,4)5/h13H,11-12H2,1-10H3 |
| InChIKey | ABMXFJZNFXHZTK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |