C19H33NO2Si — CID 134924654
[(3S,5R)-2-benzyl-3-ethyl-5-methyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 134924654) has the molecular formula C19H33NO2Si and a molecular weight of 335.56 g/mol. Its IUPAC name is [(3S,5R)-2-benzyl-3-ethyl-5-methyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3S,5R)-2-benzyl-3-ethyl-5-methyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134924654 |
| Molecular Formula | C19H33NO2Si |
| Molecular Weight | 335.56 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | [(3S,5R)-2-benzyl-3-ethyl-5-methyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC[C@H]1C[C@@](C)(O[Si](C)(C)C(C)(C)C)ON1Cc1ccccc1 |
| InChI | InChI=1S/C19H33NO2Si/c1-8-17-14-19(5,22-23(6,7)18(2,3)4)21-20(17)15-16-12-10-9-11-13-16/h9-13,17H,8,14-15H2,1-7H3/t17-,19+/m0/s1 |
| InChIKey | KTSLNGMWUDDDPS-PKOBYXMFSA-N |
| XLogP | 5.34 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.56 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|