C24H33NO4Si — CID 134924837
benzyl (2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-3-phenylazetidine-1-carboxylate (PubChem CID 134924837) has the molecular formula C24H33NO4Si and a molecular weight of 427.62 g/mol. Its IUPAC name is benzyl (2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-3-phenylazetidine-1-carboxylate.
| Compound Name | benzyl (2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-3-phenylazetidine-1-carboxylate |
|---|---|
| PubChem CID | 134924837 |
| Molecular Formula | C24H33NO4Si |
| Molecular Weight | 427.62 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | benzyl (2S,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-3-phenylazetidine-1-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1N(C(=O)OCc2ccccc2)C[C@@]1(O)c1ccccc1 |
| InChI | InChI=1S/C24H33NO4Si/c1-23(2,3)30(4,5)29-17-21-24(27,20-14-10-7-11-15-20)18-25(21)22(26)28-16-19-12-8-6-9-13-19/h6-15,21,27H,16-18H2,1-5H3/t21-,24+/m0/s1 |
| InChIKey | ACWNMPUZLZSRPO-XUZZJYLKSA-N |
| XLogP | 4.92 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.62 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|