C21H33NO — CID 134925997
N-(1-phenylbutoxy)-N-prop-2-enyloct-1-en-4-amine (PubChem CID 134925997) has the molecular formula C21H33NO and a molecular weight of 315.50 g/mol. Its IUPAC name is N-(1-phenylbutoxy)-N-prop-2-enyloct-1-en-4-amine.
| Compound Name | N-(1-phenylbutoxy)-N-prop-2-enyloct-1-en-4-amine |
|---|---|
| PubChem CID | 134925997 |
| Molecular Formula | C21H33NO |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.26 |
| IUPAC Name | N-(1-phenylbutoxy)-N-prop-2-enyloct-1-en-4-amine |
| SMILES | C=CCC(CCCC)N(CC=C)OC(CCC)c1ccccc1 |
| InChI | InChI=1S/C21H33NO/c1-5-9-17-20(13-6-2)22(18-8-4)23-21(14-7-3)19-15-11-10-12-16-19/h6,8,10-12,15-16,20-21H,2,4-5,7,9,13-14,17-18H2,1,3H3 |
| InChIKey | YBBYTRREONQWDI-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|