C28H40O2S2+2 — CID 134926060
22,27-dimethyl-4,15-dioxa-22,27-dithioniatetracyclo[16.7.3.13,24.116,20]triaconta-1,3(29),16(30),17,19,24-hexaene (PubChem CID 134926060) has the molecular formula C28H40O2S2+2 and a molecular weight of 472.76 g/mol. Its IUPAC name is 22,27-dimethyl-4,15-dioxa-22,27-dithioniatetracyclo[16.7.3.13,24.116,20]triaconta-1,3(29),16(30),17,19,24-hexaene.
| Compound Name | 22,27-dimethyl-4,15-dioxa-22,27-dithioniatetracyclo[16.7.3.13,24.116,20]triaconta-1,3(29),16(30),17,19,24-hexaene |
|---|---|
| PubChem CID | 134926060 |
| Molecular Formula | C28H40O2S2+2 |
| Molecular Weight | 472.76 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 22,27-dimethyl-4,15-dioxa-22,27-dithioniatetracyclo[16.7.3.13,24.116,20]triaconta-1,3(29),16(30),17,19,24-hexaene |
| SMILES | C[S+]1Cc2cc3cc(c2)OCCCCCCCCCCOc2cc(cc(c2)C[S+](C)C3)C1 |
| InChI | InChI=1S/C28H40O2S2/c1-31-19-23-13-25-17-27(15-23)29-11-9-7-5-3-4-6-8-10-12-30-28-16-24(20-31)14-26(18-28)22-32(2)21-25/h13-18H,3-12,19-22H2,1-2H3/q+2 |
| InChIKey | BEFZQPKCEUWFBX-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.76 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|