C32H46O10 — CID 46202197
4,7,10,13,19,22,25,28,32,39-decaoxatetracyclo[14.14.10.13,29.114,18]dotetraconta-1,3(41),14(42),15,17,29-hexaene (PubChem CID 46202197) has the molecular formula C32H46O10 and a molecular weight of 590.71 g/mol. Its IUPAC name is 4,7,10,13,19,22,25,28,32,39-decaoxatetracyclo[14.14.10.13,29.114,18]dotetraconta-1,3(41),14(42),15,17,29-hexaene.
| Compound Name | 4,7,10,13,19,22,25,28,32,39-decaoxatetracyclo[14.14.10.13,29.114,18]dotetraconta-1,3(41),14(42),15,17,29-hexaene |
|---|---|
| PubChem CID | 46202197 |
| Molecular Formula | C32H46O10 |
| Molecular Weight | 590.71 g/mol |
| Exact Mass | 590.31 |
| IUPAC Name | 4,7,10,13,19,22,25,28,32,39-decaoxatetracyclo[14.14.10.13,29.114,18]dotetraconta-1,3(41),14(42),15,17,29-hexaene |
| SMILES | c1c2cc3cc1OCCOCCOCCOc1cc(cc(c1)OCCOCCOCCO3)COCCCCCCOC2 |
| InChI | InChI=1S/C32H46O10/c1-2-4-6-38-26-28-21-31-24-32(22-28)42-18-14-36-10-8-34-12-16-40-30-20-27(25-37-5-3-1)19-29(23-30)39-15-11-33-7-9-35-13-17-41-31/h19-24H,1-18,25-26H2 |
| InChIKey | HMZLLIFFMBKLBV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.71 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|